C23H31NO3 — CID 20803731
N-ethyl-2,2-dimethyl-3-phenylmethoxy-4-propan-2-yloxy-3,4-dihydrochromen-6-amine (PubChem CID 20803731) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is N-ethyl-2,2-dimethyl-3-phenylmethoxy-4-propan-2-yloxy-3,4-dihydrochromen-6-amine.
| Compound Name | N-ethyl-2,2-dimethyl-3-phenylmethoxy-4-propan-2-yloxy-3,4-dihydrochromen-6-amine |
|---|---|
| PubChem CID | 20803731 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | N-ethyl-2,2-dimethyl-3-phenylmethoxy-4-propan-2-yloxy-3,4-dihydrochromen-6-amine |
| SMILES | CCNc1ccc2c(c1)C(OC(C)C)C(OCc1ccccc1)C(C)(C)O2 |
| InChI | InChI=1S/C23H31NO3/c1-6-24-18-12-13-20-19(14-18)21(26-16(2)3)22(23(4,5)27-20)25-15-17-10-8-7-9-11-17/h7-14,16,21-22,24H,6,15H2,1-5H3 |
| InChIKey | POQYJCDUTYWYLT-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|