C19H27NO3 — CID 20804187
4-butoxy-N,2,2-trimethyl-3-prop-2-ynoxy-3,4-dihydrochromen-6-amine (PubChem CID 20804187) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is 4-butoxy-N,2,2-trimethyl-3-prop-2-ynoxy-3,4-dihydrochromen-6-amine.
| Compound Name | 4-butoxy-N,2,2-trimethyl-3-prop-2-ynoxy-3,4-dihydrochromen-6-amine |
|---|---|
| PubChem CID | 20804187 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | 4-butoxy-N,2,2-trimethyl-3-prop-2-ynoxy-3,4-dihydrochromen-6-amine |
| SMILES | C#CCOC1C(OCCCC)c2cc(NC)ccc2OC1(C)C |
| InChI | InChI=1S/C19H27NO3/c1-6-8-12-21-17-15-13-14(20-5)9-10-16(15)23-19(3,4)18(17)22-11-7-2/h2,9-10,13,17-18,20H,6,8,11-12H2,1,3-5H3 |
| InChIKey | BGGUZZCVRJDOQM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|