C22H27NO3 — CID 11451044
N,2,2-trimethyl-4-phenylmethoxy-3-prop-2-enoxy-3,4-dihydrochromen-6-amine (PubChem CID 11451044) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is N,2,2-trimethyl-4-phenylmethoxy-3-prop-2-enoxy-3,4-dihydrochromen-6-amine.
| Compound Name | N,2,2-trimethyl-4-phenylmethoxy-3-prop-2-enoxy-3,4-dihydrochromen-6-amine |
|---|---|
| PubChem CID | 11451044 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | N,2,2-trimethyl-4-phenylmethoxy-3-prop-2-enoxy-3,4-dihydrochromen-6-amine |
| SMILES | C=CCOC1C(OCc2ccccc2)c2cc(NC)ccc2OC1(C)C |
| InChI | InChI=1S/C22H27NO3/c1-5-13-24-21-20(25-15-16-9-7-6-8-10-16)18-14-17(23-4)11-12-19(18)26-22(21,2)3/h5-12,14,20-21,23H,1,13,15H2,2-4H3 |
| InChIKey | JJIRVLOMTBYGSZ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|