About 1-bromo-4-ethylbenzene
1-bromo-4-ethylbenzene (PubChem CID 20805498) has the molecular formula C8H8Br-
and a molecular weight of 184.06 g/mol. Its IUPAC name is 1-bromo-4-ethylbenzene.
Molecular Properties
| Compound Name | 1-bromo-4-ethylbenzene |
| PubChem CID | 20805498 |
| Molecular Formula | C8H8Br- |
| Molecular Weight | 184.06 g/mol |
| Exact Mass | 182.98 |
| IUPAC Name | 1-bromo-4-ethylbenzene |
| SMILES | [CH2-]Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C8H8Br/c1-2-7-3-5-8(9)6-4-7/h3-6H,1-2H2/q-1 |
| InChIKey | XIYJCYSXOXZPRK-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.06 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-4-ethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-ethylbenzene?
The IUPAC name of 1-bromo-4-ethylbenzene (CID 20805498) is 1-bromo-4-ethylbenzene.
What is the SMILES notation for 1-bromo-4-ethylbenzene?
The canonical SMILES for 1-bromo-4-ethylbenzene is [CH2-]Cc1ccc(Br)cc1.
What is the InChIKey of 1-bromo-4-ethylbenzene?
The InChIKey is XIYJCYSXOXZPRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8Br/c1-2-7-3-5-8(9)6-4-7/h3-6H,1-2H2/q-1.
What are the key properties of 1-bromo-4-ethylbenzene?
1-bromo-4-ethylbenzene has a molecular weight of 184.06 g/mol, XLogP of 2.83, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-ethylbenzene is sourced from PubChem (CID 20805498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).