C19H22N2O — CID 20806998
1-benzyl-4,5-dimethyl-3-phenylmethoxy-2H-imidazole (PubChem CID 20806998) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is 1-benzyl-4,5-dimethyl-3-phenylmethoxy-2H-imidazole.
| Compound Name | 1-benzyl-4,5-dimethyl-3-phenylmethoxy-2H-imidazole |
|---|---|
| PubChem CID | 20806998 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 1-benzyl-4,5-dimethyl-3-phenylmethoxy-2H-imidazole |
| SMILES | CC1=C(C)N(OCc2ccccc2)CN1Cc1ccccc1 |
| InChI | InChI=1S/C19H22N2O/c1-16-17(2)21(22-14-19-11-7-4-8-12-19)15-20(16)13-18-9-5-3-6-10-18/h3-12H,13-15H2,1-2H3 |
| InChIKey | PGKAQDJDCZKVNL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |