C19H19FN2O — CID 87433038
7-[(4-fluorophenyl)methoxy]-2,3-dimethyl-1-prop-2-ynyl-7aH-pyrrolo[2,3-b]pyridine (PubChem CID 87433038) has the molecular formula C19H19FN2O and a molecular weight of 310.37 g/mol. Its IUPAC name is 7-[(4-fluorophenyl)methoxy]-2,3-dimethyl-1-prop-2-ynyl-7aH-pyrrolo[2,3-b]pyridine.
| Compound Name | 7-[(4-fluorophenyl)methoxy]-2,3-dimethyl-1-prop-2-ynyl-7aH-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 87433038 |
| Molecular Formula | C19H19FN2O |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 7-[(4-fluorophenyl)methoxy]-2,3-dimethyl-1-prop-2-ynyl-7aH-pyrrolo[2,3-b]pyridine |
| SMILES | C#CCN1C(C)=C(C)C2=CC=CN(OCc3ccc(F)cc3)C21 |
| InChI | InChI=1S/C19H19FN2O/c1-4-11-21-15(3)14(2)18-6-5-12-22(19(18)21)23-13-16-7-9-17(20)10-8-16/h1,5-10,12,19H,11,13H2,2-3H3 |
| InChIKey | HUIWGALMCVVILW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|