C9H5Cl2N3O — CID 20807
2,4-dichloro-6-phenoxy-1,3,5-triazine (PubChem CID 20807) has the molecular formula C9H5Cl2N3O and a molecular weight of 242.07 g/mol. Its IUPAC name is 2,4-dichloro-6-phenoxy-1,3,5-triazine.
| Compound Name | 2,4-dichloro-6-phenoxy-1,3,5-triazine |
|---|---|
| PubChem CID | 20807 |
| Molecular Formula | C9H5Cl2N3O |
| Molecular Weight | 242.07 g/mol |
| Exact Mass | 240.98 |
| IUPAC Name | 2,4-dichloro-6-phenoxy-1,3,5-triazine |
| SMILES | Clc1nc(Cl)nc(Oc2ccccc2)n1 |
| InChI | InChI=1S/C9H5Cl2N3O/c10-7-12-8(11)14-9(13-7)15-6-4-2-1-3-5-6/h1-5H |
| InChIKey | ACMVCGAZNQJQFJ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.07 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |