C13H14F3IrN2O3- — CID 20807125
(Z)-4-hydroxypent-3-en-2-one;iridium;pyridin-2-ylmethyl-(2,2,2-trifluoroacetyl)azanide (PubChem CID 20807125) has the molecular formula C13H14F3IrN2O3- and a molecular weight of 495.48 g/mol. Its IUPAC name is (Z)-4-hydroxypent-3-en-2-one;iridium;pyridin-2-ylmethyl-(2,2,2-trifluoroacetyl)azanide.
| Compound Name | (Z)-4-hydroxypent-3-en-2-one;iridium;pyridin-2-ylmethyl-(2,2,2-trifluoroacetyl)azanide |
|---|---|
| PubChem CID | 20807125 |
| Molecular Formula | C13H14F3IrN2O3- |
| Molecular Weight | 495.48 g/mol |
| Exact Mass | 496.06 |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;iridium;pyridin-2-ylmethyl-(2,2,2-trifluoroacetyl)azanide |
| SMILES | CC(=O)/C=C(/C)O.O=C([N-]Cc1ccccn1)C(F)(F)F.[Ir] |
| InChI | InChI=1S/C8H7F3N2O.C5H8O2.Ir/c9-8(10,11)7(14)13-5-6-3-1-2-4-12-6;1-4(6)3-5(2)7;/h1-4H,5H2,(H,13,14);3,6H,1-2H3;/p-1/b;4-3-; |
| InChIKey | JLLPXRZALLKMPX-LWFKIUJUSA-M |
| XLogP | 3.08 |
| TPSA | 81.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.48 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|