C18H12F5IrN3O2S-2 — CID 20807187
2-(2,4-difluorobenzene-6-id-1-yl)pyridine;iridium;pyridin-2-ylmethyl(trifluoromethylsulfonyl)azanide (PubChem CID 20807187) has the molecular formula C18H12F5IrN3O2S-2 and a molecular weight of 621.59 g/mol. Its IUPAC name is 2-(2,4-difluorobenzene-6-id-1-yl)pyridine;iridium;pyridin-2-ylmethyl(trifluoromethylsulfonyl)azanide.
| Compound Name | 2-(2,4-difluorobenzene-6-id-1-yl)pyridine;iridium;pyridin-2-ylmethyl(trifluoromethylsulfonyl)azanide |
|---|---|
| PubChem CID | 20807187 |
| Molecular Formula | C18H12F5IrN3O2S-2 |
| Molecular Weight | 621.59 g/mol |
| Exact Mass | 622.02 |
| IUPAC Name | 2-(2,4-difluorobenzene-6-id-1-yl)pyridine;iridium;pyridin-2-ylmethyl(trifluoromethylsulfonyl)azanide |
| SMILES | Fc1c[c-]c(-c2ccccn2)c(F)c1.O=S(=O)([N-]Cc1ccccn1)C(F)(F)F.[Ir] |
| InChI | InChI=1S/C11H6F2N.C7H6F3N2O2S.Ir/c12-8-4-5-9(10(13)7-8)11-3-1-2-6-14-11;8-7(9,10)15(13,14)12-5-6-3-1-2-4-11-6;/h1-4,6-7H;1-4H,5H2;/q2*-1; |
| InChIKey | RSIGRSCBGSOZRF-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 74.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.59 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|