About carbanide;chloroiridium(2+);2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine
carbanide;chloroiridium(2+);2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine (PubChem CID 20807346) has the molecular formula C10H8ClF3IrN3
and a molecular weight of 454.86 g/mol. Its IUPAC name is carbanide;chloroiridium(2+);2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine.
Molecular Properties
| Compound Name | carbanide;chloroiridium(2+);2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine |
| PubChem CID | 20807346 |
| Molecular Formula | C10H8ClF3IrN3 |
| Molecular Weight | 454.86 g/mol |
| Exact Mass | 455.00 |
| IUPAC Name | carbanide;chloroiridium(2+);2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine |
| SMILES | Cl[Ir+2].FC(F)(F)c1cc(-c2ccccn2)[n-]n1.[CH3-] |
| InChI | InChI=1S/C9H5F3N3.CH3.ClH.Ir/c10-9(11,12)8-5-7(14-15-8)6-3-1-2-4-13-6;;;/h1-5H;1H3;1H;/q2*-1;;+3/p-1 |
| InChIKey | ZRFUDYNAUSRPAK-UHFFFAOYSA-M |
| XLogP | 3.26 |
| TPSA | 39.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.86 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;chloroiridium(2+);2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;chloroiridium(2+);2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine?
The IUPAC name of carbanide;chloroiridium(2+);2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine (CID 20807346) is carbanide;chloroiridium(2+);2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine.
What is the SMILES notation for carbanide;chloroiridium(2+);2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine?
The canonical SMILES for carbanide;chloroiridium(2+);2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine is Cl[Ir+2].FC(F)(F)c1cc(-c2ccccn2)[n-]n1.[CH3-].
What is the InChIKey of carbanide;chloroiridium(2+);2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine?
The InChIKey is ZRFUDYNAUSRPAK-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H5F3N3.CH3.ClH.Ir/c10-9(11,12)8-5-7(14-15-8)6-3-1-2-4-13-6;;;/h1-5H;1H3;1H;/q2*-1;;+3/p-1.
What are the key properties of carbanide;chloroiridium(2+);2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine?
carbanide;chloroiridium(2+);2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine has a molecular weight of 454.86 g/mol, XLogP of 3.26, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;chloroiridium(2+);2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine is sourced from PubChem (CID 20807346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).