C27H33F3 — CID 20807500
3-[(2R,4aR)-6-propyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-7-but-3-enyl-1,2,8-trifluoronaphthalene (PubChem CID 20807500) has the molecular formula C27H33F3 and a molecular weight of 414.56 g/mol. Its IUPAC name is 3-[(2R,4aR)-6-propyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-7-but-3-enyl-1,2,8-trifluoronaphthalene.
| Compound Name | 3-[(2R,4aR)-6-propyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-7-but-3-enyl-1,2,8-trifluoronaphthalene |
|---|---|
| PubChem CID | 20807500 |
| Molecular Formula | C27H33F3 |
| Molecular Weight | 414.56 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | 3-[(2R,4aR)-6-propyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-7-but-3-enyl-1,2,8-trifluoronaphthalene |
| SMILES | C=CCCc1ccc2cc([C@@H]3CC[C@@H]4CC(CCC)CCC4C3)c(F)c(F)c2c1F |
| InChI | InChI=1S/C27H33F3/c1-3-5-7-18-10-13-22-16-23(26(29)27(30)24(22)25(18)28)21-12-11-19-14-17(6-4-2)8-9-20(19)15-21/h3,10,13,16-17,19-21H,1,4-9,11-12,14-15H2,2H3/t17?,19-,20?,21-/m1/s1 |
| InChIKey | XLEAVWHDGHLPQZ-BCKAPOECSA-N |
| XLogP | 8.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.56 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|