C20H16N4 — CID 2080971
1-[4-(1H-benzimidazol-2-yl)phenyl]-2,5-dimethylpyrrole-3-carbonitrile (PubChem CID 2080971) has the molecular formula C20H16N4 and a molecular weight of 312.38 g/mol. Its IUPAC name is 1-[4-(1H-benzimidazol-2-yl)phenyl]-2,5-dimethylpyrrole-3-carbonitrile.
| Compound Name | 1-[4-(1H-benzimidazol-2-yl)phenyl]-2,5-dimethylpyrrole-3-carbonitrile |
|---|---|
| PubChem CID | 2080971 |
| Molecular Formula | C20H16N4 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 1-[4-(1H-benzimidazol-2-yl)phenyl]-2,5-dimethylpyrrole-3-carbonitrile |
| SMILES | Cc1cc(C#N)c(C)n1-c1ccc(-c2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C20H16N4/c1-13-11-16(12-21)14(2)24(13)17-9-7-15(8-10-17)20-22-18-5-3-4-6-19(18)23-20/h3-11H,1-2H3,(H,22,23) |
| InChIKey | SIZNUSPTUNTOMP-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 57.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|