C13H11N3 — CID 20810342
7-methyl-3-phenylimidazo[1,2-c]pyrimidine (PubChem CID 20810342) has the molecular formula C13H11N3 and a molecular weight of 209.25 g/mol. Its IUPAC name is 7-methyl-3-phenylimidazo[1,2-c]pyrimidine.
| Compound Name | 7-methyl-3-phenylimidazo[1,2-c]pyrimidine |
|---|---|
| PubChem CID | 20810342 |
| Molecular Formula | C13H11N3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 7-methyl-3-phenylimidazo[1,2-c]pyrimidine |
| SMILES | Cc1cc2ncc(-c3ccccc3)n2cn1 |
| InChI | InChI=1S/C13H11N3/c1-10-7-13-14-8-12(16(13)9-15-10)11-5-3-2-4-6-11/h2-9H,1H3 |
| InChIKey | LMOHNRJWWQMGKK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |