C15H14N2O3S — CID 20812240
ethyl 2-[hydroxy(1H-indol-3-yl)methyl]-1,3-thiazole-4-carboxylate (PubChem CID 20812240) has the molecular formula C15H14N2O3S and a molecular weight of 302.36 g/mol. Its IUPAC name is ethyl 2-[hydroxy(1H-indol-3-yl)methyl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[hydroxy(1H-indol-3-yl)methyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 20812240 |
| Molecular Formula | C15H14N2O3S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | ethyl 2-[hydroxy(1H-indol-3-yl)methyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(C(O)c2c[nH]c3ccccc23)n1 |
| InChI | InChI=1S/C15H14N2O3S/c1-2-20-15(19)12-8-21-14(17-12)13(18)10-7-16-11-6-4-3-5-9(10)11/h3-8,13,16,18H,2H2,1H3 |
| InChIKey | ZIPZDDZQNSVPNR-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |