C24H26O2 — CID 20813193
(1-naphthalen-1-yl-1-phenylethyl) 2,2-dimethylbutanoate (PubChem CID 20813193) has the molecular formula C24H26O2 and a molecular weight of 346.47 g/mol. Its IUPAC name is (1-naphthalen-1-yl-1-phenylethyl) 2,2-dimethylbutanoate.
| Compound Name | (1-naphthalen-1-yl-1-phenylethyl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 20813193 |
| Molecular Formula | C24H26O2 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | (1-naphthalen-1-yl-1-phenylethyl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC(C)(c1ccccc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C24H26O2/c1-5-23(2,3)22(25)26-24(4,19-14-7-6-8-15-19)21-17-11-13-18-12-9-10-16-20(18)21/h6-17H,5H2,1-4H3 |
| InChIKey | DFIKPHUKRREUQB-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |