C22H29N3O4 — CID 20814081
6-[2-(acetyloxymethyl)-5-isocyanobenzimidazol-1-yl]hexyl 2,2-dimethylpropanoate (PubChem CID 20814081) has the molecular formula C22H29N3O4 and a molecular weight of 399.49 g/mol. Its IUPAC name is 6-[2-(acetyloxymethyl)-5-isocyanobenzimidazol-1-yl]hexyl 2,2-dimethylpropanoate.
| Compound Name | 6-[2-(acetyloxymethyl)-5-isocyanobenzimidazol-1-yl]hexyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 20814081 |
| Molecular Formula | C22H29N3O4 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | 6-[2-(acetyloxymethyl)-5-isocyanobenzimidazol-1-yl]hexyl 2,2-dimethylpropanoate |
| SMILES | [C-]#[N+]c1ccc2c(c1)nc(COC(C)=O)n2CCCCCCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C22H29N3O4/c1-16(26)29-15-20-24-18-14-17(23-5)10-11-19(18)25(20)12-8-6-7-9-13-28-21(27)22(2,3)4/h10-11,14H,6-9,12-13,15H2,1-4H3 |
| InChIKey | LANLZBWNGHALBY-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 74.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|