C29H29ClN8O2 — CID 20814456
2-[[2-[(3-chlorophenyl)methylamino]-6-imidazol-1-ylpyrimidin-4-yl]amino]-N-[(4-isocyanophenyl)methyl]-2-(oxan-4-yl)acetamide (PubChem CID 20814456) has the molecular formula C29H29ClN8O2 and a molecular weight of 557.06 g/mol. Its IUPAC name is 2-[[2-[(3-chlorophenyl)methylamino]-6-imidazol-1-ylpyrimidin-4-yl]amino]-N-[(4-isocyanophenyl)methyl]-2-(oxan-4-yl)acetamide.
| Compound Name | 2-[[2-[(3-chlorophenyl)methylamino]-6-imidazol-1-ylpyrimidin-4-yl]amino]-N-[(4-isocyanophenyl)methyl]-2-(oxan-4-yl)acetamide |
|---|---|
| PubChem CID | 20814456 |
| Molecular Formula | C29H29ClN8O2 |
| Molecular Weight | 557.06 g/mol |
| Exact Mass | 556.21 |
| IUPAC Name | 2-[[2-[(3-chlorophenyl)methylamino]-6-imidazol-1-ylpyrimidin-4-yl]amino]-N-[(4-isocyanophenyl)methyl]-2-(oxan-4-yl)acetamide |
| SMILES | [C-]#[N+]c1ccc(CNC(=O)C(Nc2cc(-n3ccnc3)nc(NCc3cccc(Cl)c3)n2)C2CCOCC2)cc1 |
| InChI | InChI=1S/C29H29ClN8O2/c1-31-24-7-5-20(6-8-24)17-33-28(39)27(22-9-13-40-14-10-22)35-25-16-26(38-12-11-32-19-38)37-29(36-25)34-18-21-3-2-4-23(30)15-21/h2-8,11-12,15-16,19,22,27H,9-10,13-14,17-18H2,(H,33,39)(H2,34,35,36,37) |
| InChIKey | TZSBKAXUAMLYPW-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 110.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.06 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|