C27H34N8O2 — CID 20814615
3-cyclohexyl-2-[[6-imidazol-1-yl-2-(2-methoxyethylamino)pyrimidin-4-yl]amino]-N-[(4-isocyanophenyl)methyl]propanamide (PubChem CID 20814615) has the molecular formula C27H34N8O2 and a molecular weight of 502.62 g/mol. Its IUPAC name is 3-cyclohexyl-2-[[6-imidazol-1-yl-2-(2-methoxyethylamino)pyrimidin-4-yl]amino]-N-[(4-isocyanophenyl)methyl]propanamide.
| Compound Name | 3-cyclohexyl-2-[[6-imidazol-1-yl-2-(2-methoxyethylamino)pyrimidin-4-yl]amino]-N-[(4-isocyanophenyl)methyl]propanamide |
|---|---|
| PubChem CID | 20814615 |
| Molecular Formula | C27H34N8O2 |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | 3-cyclohexyl-2-[[6-imidazol-1-yl-2-(2-methoxyethylamino)pyrimidin-4-yl]amino]-N-[(4-isocyanophenyl)methyl]propanamide |
| SMILES | [C-]#[N+]c1ccc(CNC(=O)C(CC2CCCCC2)Nc2cc(-n3ccnc3)nc(NCCOC)n2)cc1 |
| InChI | InChI=1S/C27H34N8O2/c1-28-22-10-8-21(9-11-22)18-31-26(36)23(16-20-6-4-3-5-7-20)32-24-17-25(35-14-12-29-19-35)34-27(33-24)30-13-15-37-2/h8-12,14,17,19-20,23H,3-7,13,15-16,18H2,2H3,(H,31,36)(H2,30,32,33,34) |
| InChIKey | IUVPZNLLJZIFFH-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 110.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|