C26H31N7O — CID 20814684
3-cyclopentyl-2-[[2-(ethylamino)-6-pyrrol-1-ylpyrimidin-4-yl]amino]-N-[(4-isocyanophenyl)methyl]propanamide (PubChem CID 20814684) has the molecular formula C26H31N7O and a molecular weight of 457.58 g/mol. Its IUPAC name is 3-cyclopentyl-2-[[2-(ethylamino)-6-pyrrol-1-ylpyrimidin-4-yl]amino]-N-[(4-isocyanophenyl)methyl]propanamide.
| Compound Name | 3-cyclopentyl-2-[[2-(ethylamino)-6-pyrrol-1-ylpyrimidin-4-yl]amino]-N-[(4-isocyanophenyl)methyl]propanamide |
|---|---|
| PubChem CID | 20814684 |
| Molecular Formula | C26H31N7O |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | 3-cyclopentyl-2-[[2-(ethylamino)-6-pyrrol-1-ylpyrimidin-4-yl]amino]-N-[(4-isocyanophenyl)methyl]propanamide |
| SMILES | [C-]#[N+]c1ccc(CNC(=O)C(CC2CCCC2)Nc2cc(-n3cccc3)nc(NCC)n2)cc1 |
| InChI | InChI=1S/C26H31N7O/c1-3-28-26-31-23(17-24(32-26)33-14-6-7-15-33)30-22(16-19-8-4-5-9-19)25(34)29-18-20-10-12-21(27-2)13-11-20/h6-7,10-15,17,19,22H,3-5,8-9,16,18H2,1H3,(H,29,34)(H2,28,30,31,32) |
| InChIKey | PHCNUCWHWPTSDX-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 88.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|