C29H35N7O2 — CID 59122241
(2R)-3-cyclohexyl-N-[(4-isocyanophenyl)methyl]-2-[(2-morpholin-4-yl-6-pyrrol-1-ylpyrimidin-4-yl)amino]propanamide (PubChem CID 59122241) has the molecular formula C29H35N7O2 and a molecular weight of 513.65 g/mol. Its IUPAC name is (2R)-3-cyclohexyl-N-[(4-isocyanophenyl)methyl]-2-[(2-morpholin-4-yl-6-pyrrol-1-ylpyrimidin-4-yl)amino]propanamide.
| Compound Name | (2R)-3-cyclohexyl-N-[(4-isocyanophenyl)methyl]-2-[(2-morpholin-4-yl-6-pyrrol-1-ylpyrimidin-4-yl)amino]propanamide |
|---|---|
| PubChem CID | 59122241 |
| Molecular Formula | C29H35N7O2 |
| Molecular Weight | 513.65 g/mol |
| Exact Mass | 513.29 |
| IUPAC Name | (2R)-3-cyclohexyl-N-[(4-isocyanophenyl)methyl]-2-[(2-morpholin-4-yl-6-pyrrol-1-ylpyrimidin-4-yl)amino]propanamide |
| SMILES | [C-]#[N+]c1ccc(CNC(=O)[C@@H](CC2CCCCC2)Nc2cc(-n3cccc3)nc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C29H35N7O2/c1-30-24-11-9-23(10-12-24)21-31-28(37)25(19-22-7-3-2-4-8-22)32-26-20-27(35-13-5-6-14-35)34-29(33-26)36-15-17-38-18-16-36/h5-6,9-14,20,22,25H,2-4,7-8,15-19,21H2,(H,31,37)(H,32,33,34)/t25-/m1/s1 |
| InChIKey | OPTOSPIIZYCWFA-RUZDIDTESA-N |
| XLogP | 4.72 |
| TPSA | 88.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.65 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|