C28H34N8O2 — CID 59122359
(2R)-3-cyclohexyl-2-[[2-[[(2E)-2-hydroxyiminopropyl]amino]-6-pyrrol-1-ylpyrimidin-4-yl]amino]-N-[(4-isocyanophenyl)methyl]propanamide (PubChem CID 59122359) has the molecular formula C28H34N8O2 and a molecular weight of 514.63 g/mol. Its IUPAC name is (2R)-3-cyclohexyl-2-[[2-[[(2E)-2-hydroxyiminopropyl]amino]-6-pyrrol-1-ylpyrimidin-4-yl]amino]-N-[(4-isocyanophenyl)methyl]propanamide.
| Compound Name | (2R)-3-cyclohexyl-2-[[2-[[(2E)-2-hydroxyiminopropyl]amino]-6-pyrrol-1-ylpyrimidin-4-yl]amino]-N-[(4-isocyanophenyl)methyl]propanamide |
|---|---|
| PubChem CID | 59122359 |
| Molecular Formula | C28H34N8O2 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.28 |
| IUPAC Name | (2R)-3-cyclohexyl-2-[[2-[[(2E)-2-hydroxyiminopropyl]amino]-6-pyrrol-1-ylpyrimidin-4-yl]amino]-N-[(4-isocyanophenyl)methyl]propanamide |
| SMILES | [C-]#[N+]c1ccc(CNC(=O)[C@@H](CC2CCCCC2)Nc2cc(-n3cccc3)nc(NC/C(C)=N/O)n2)cc1 |
| InChI | InChI=1S/C28H34N8O2/c1-20(35-38)18-31-28-33-25(17-26(34-28)36-14-6-7-15-36)32-24(16-21-8-4-3-5-9-21)27(37)30-19-22-10-12-23(29-2)13-11-22/h6-7,10-15,17,21,24,38H,3-5,8-9,16,18-19H2,1H3,(H,30,37)(H2,31,32,33,34)/b35-20+/t24-/m1/s1 |
| InChIKey | YOAJVYSTCBECBW-FQYGQZBOSA-N |
| XLogP | 5.15 |
| TPSA | 120.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|