C26H32N8O — CID 59122176
(2R)-3-cyclohexyl-2-[[2-(ethylamino)-6-imidazol-1-ylpyrimidin-4-yl]amino]-N-[(4-isocyanophenyl)methyl]propanamide (PubChem CID 59122176) has the molecular formula C26H32N8O and a molecular weight of 472.60 g/mol. Its IUPAC name is (2R)-3-cyclohexyl-2-[[2-(ethylamino)-6-imidazol-1-ylpyrimidin-4-yl]amino]-N-[(4-isocyanophenyl)methyl]propanamide.
| Compound Name | (2R)-3-cyclohexyl-2-[[2-(ethylamino)-6-imidazol-1-ylpyrimidin-4-yl]amino]-N-[(4-isocyanophenyl)methyl]propanamide |
|---|---|
| PubChem CID | 59122176 |
| Molecular Formula | C26H32N8O |
| Molecular Weight | 472.60 g/mol |
| Exact Mass | 472.27 |
| IUPAC Name | (2R)-3-cyclohexyl-2-[[2-(ethylamino)-6-imidazol-1-ylpyrimidin-4-yl]amino]-N-[(4-isocyanophenyl)methyl]propanamide |
| SMILES | [C-]#[N+]c1ccc(CNC(=O)[C@@H](CC2CCCCC2)Nc2cc(-n3ccnc3)nc(NCC)n2)cc1 |
| InChI | InChI=1S/C26H32N8O/c1-3-29-26-32-23(16-24(33-26)34-14-13-28-18-34)31-22(15-19-7-5-4-6-8-19)25(35)30-17-20-9-11-21(27-2)12-10-20/h9-14,16,18-19,22H,3-8,15,17H2,1H3,(H,30,35)(H2,29,31,32,33)/t22-/m1/s1 |
| InChIKey | VLINCYIQISNKNR-JOCHJYFZSA-N |
| XLogP | 4.71 |
| TPSA | 101.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.60 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|