C25H28ClN7O — CID 20814504
2-[(2-amino-6-pyrrol-1-ylpyrimidin-4-yl)amino]-N-[(2-chloro-4-isocyanophenyl)methyl]-3-cyclohexylpropanamide (PubChem CID 20814504) has the molecular formula C25H28ClN7O and a molecular weight of 478.00 g/mol. Its IUPAC name is 2-[(2-amino-6-pyrrol-1-ylpyrimidin-4-yl)amino]-N-[(2-chloro-4-isocyanophenyl)methyl]-3-cyclohexylpropanamide.
| Compound Name | 2-[(2-amino-6-pyrrol-1-ylpyrimidin-4-yl)amino]-N-[(2-chloro-4-isocyanophenyl)methyl]-3-cyclohexylpropanamide |
|---|---|
| PubChem CID | 20814504 |
| Molecular Formula | C25H28ClN7O |
| Molecular Weight | 478.00 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | 2-[(2-amino-6-pyrrol-1-ylpyrimidin-4-yl)amino]-N-[(2-chloro-4-isocyanophenyl)methyl]-3-cyclohexylpropanamide |
| SMILES | [C-]#[N+]c1ccc(CNC(=O)C(CC2CCCCC2)Nc2cc(-n3cccc3)nc(N)n2)c(Cl)c1 |
| InChI | InChI=1S/C25H28ClN7O/c1-28-19-10-9-18(20(26)14-19)16-29-24(34)21(13-17-7-3-2-4-8-17)30-22-15-23(32-25(27)31-22)33-11-5-6-12-33/h5-6,9-12,14-15,17,21H,2-4,7-8,13,16H2,(H,29,34)(H3,27,30,31,32) |
| InChIKey | NGNPMMVDFLUVAN-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.00 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|