C19H16F3NO3S — CID 20816525
(3-isoquinolin-5-ylphenyl) 4,4,4-trifluorobutane-1-sulfonate (PubChem CID 20816525) has the molecular formula C19H16F3NO3S and a molecular weight of 395.40 g/mol. Its IUPAC name is (3-isoquinolin-5-ylphenyl) 4,4,4-trifluorobutane-1-sulfonate.
| Compound Name | (3-isoquinolin-5-ylphenyl) 4,4,4-trifluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 20816525 |
| Molecular Formula | C19H16F3NO3S |
| Molecular Weight | 395.40 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | (3-isoquinolin-5-ylphenyl) 4,4,4-trifluorobutane-1-sulfonate |
| SMILES | O=S(=O)(CCCC(F)(F)F)Oc1cccc(-c2cccc3cnccc23)c1 |
| InChI | InChI=1S/C19H16F3NO3S/c20-19(21,22)9-3-11-27(24,25)26-16-6-1-4-14(12-16)17-7-2-5-15-13-23-10-8-18(15)17/h1-2,4-8,10,12-13H,3,9,11H2 |
| InChIKey | UBDXBLGQGVQXEX-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.40 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|