C8H11N — CID 20817701
N-(2,5-dimethylcyclopenta-2,4-dien-1-yl)methanimine (PubChem CID 20817701) has the molecular formula C8H11N and a molecular weight of 121.18 g/mol. Its IUPAC name is N-(2,5-dimethylcyclopenta-2,4-dien-1-yl)methanimine.
| Compound Name | N-(2,5-dimethylcyclopenta-2,4-dien-1-yl)methanimine |
|---|---|
| PubChem CID | 20817701 |
| Molecular Formula | C8H11N |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.09 |
| IUPAC Name | N-(2,5-dimethylcyclopenta-2,4-dien-1-yl)methanimine |
| SMILES | C=NC1C(C)=CC=C1C |
| InChI | InChI=1S/C8H11N/c1-6-4-5-7(2)8(6)9-3/h4-5,8H,3H2,1-2H3 |
| InChIKey | MLOHDQNFKSOARE-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|