C8H9N — CID 123336992
N-(6-methylidenecyclohexa-2,4-dien-1-yl)methanimine (PubChem CID 123336992) has the molecular formula C8H9N and a molecular weight of 119.17 g/mol. Its IUPAC name is N-(6-methylidenecyclohexa-2,4-dien-1-yl)methanimine.
| Compound Name | N-(6-methylidenecyclohexa-2,4-dien-1-yl)methanimine |
|---|---|
| PubChem CID | 123336992 |
| Molecular Formula | C8H9N |
| Molecular Weight | 119.17 g/mol |
| Exact Mass | 119.07 |
| IUPAC Name | N-(6-methylidenecyclohexa-2,4-dien-1-yl)methanimine |
| SMILES | C=NC1C=CC=CC1=C |
| InChI | InChI=1S/C8H9N/c1-7-5-3-4-6-8(7)9-2/h3-6,8H,1-2H2 |
| InChIKey | MDRAUAZDXUDSTA-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 119.17 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|