C8H13N — CID 123466904
N-hepta-4,6-dien-2-ylmethanimine (PubChem CID 123466904) has the molecular formula C8H13N and a molecular weight of 123.20 g/mol. Its IUPAC name is N-hepta-4,6-dien-2-ylmethanimine.
| Compound Name | N-hepta-4,6-dien-2-ylmethanimine |
|---|---|
| PubChem CID | 123466904 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | N-hepta-4,6-dien-2-ylmethanimine |
| SMILES | C=CC=CCC(C)N=C |
| InChI | InChI=1S/C8H13N/c1-4-5-6-7-8(2)9-3/h4-6,8H,1,3,7H2,2H3 |
| InChIKey | AAVRSJFWZFAUGD-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|