C21H25N3O — CID 20819149
4-[[2-methyl-3-(4-propan-2-ylphenyl)propyl]amino]-2H-phthalazin-1-one (PubChem CID 20819149) has the molecular formula C21H25N3O and a molecular weight of 335.45 g/mol. Its IUPAC name is 4-[[2-methyl-3-(4-propan-2-ylphenyl)propyl]amino]-2H-phthalazin-1-one.
| Compound Name | 4-[[2-methyl-3-(4-propan-2-ylphenyl)propyl]amino]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 20819149 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 4-[[2-methyl-3-(4-propan-2-ylphenyl)propyl]amino]-2H-phthalazin-1-one |
| SMILES | CC(CNc1n[nH]c(=O)c2ccccc12)Cc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C21H25N3O/c1-14(2)17-10-8-16(9-11-17)12-15(3)13-22-20-18-6-4-5-7-19(18)21(25)24-23-20/h4-11,14-15H,12-13H2,1-3H3,(H,22,23)(H,24,25) |
| InChIKey | SMLDXASPIYWMQZ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |