About 4-amino-2H-phthalazin-1-one;methane;4-(propan-2-ylamino)-2H-phthalazin-1-one
4-amino-2H-phthalazin-1-one;methane;4-(propan-2-ylamino)-2H-phthalazin-1-one (PubChem CID 160790771) has the molecular formula C20H24N6O2
and a molecular weight of 380.45 g/mol. Its IUPAC name is 4-amino-2H-phthalazin-1-one;methane;4-(propan-2-ylamino)-2H-phthalazin-1-one.
Molecular Properties
| Compound Name | 4-amino-2H-phthalazin-1-one;methane;4-(propan-2-ylamino)-2H-phthalazin-1-one |
| PubChem CID | 160790771 |
| Molecular Formula | C20H24N6O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 4-amino-2H-phthalazin-1-one;methane;4-(propan-2-ylamino)-2H-phthalazin-1-one |
| SMILES | C.CC(C)Nc1n[nH]c(=O)c2ccccc12.Nc1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C11H13N3O.C8H7N3O.CH4/c1-7(2)12-10-8-5-3-4-6-9(8)11(15)14-13-10;9-7-5-3-1-2-4-6(5)8(12)11-10-7;/h3-7H,1-2H3,(H,12,13)(H,14,15);1-4H,(H2,9,10)(H,11,12);1H4 |
| InChIKey | SBUJOJWBXSVQAB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 129.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-amino-2H-phthalazin-1-one;methane;4-(propan-2-ylamino)-2H-phthalazin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2H-phthalazin-1-one;methane;4-(propan-2-ylamino)-2H-phthalazin-1-one?
The IUPAC name of 4-amino-2H-phthalazin-1-one;methane;4-(propan-2-ylamino)-2H-phthalazin-1-one (CID 160790771) is 4-amino-2H-phthalazin-1-one;methane;4-(propan-2-ylamino)-2H-phthalazin-1-one.
What is the SMILES notation for 4-amino-2H-phthalazin-1-one;methane;4-(propan-2-ylamino)-2H-phthalazin-1-one?
The canonical SMILES for 4-amino-2H-phthalazin-1-one;methane;4-(propan-2-ylamino)-2H-phthalazin-1-one is C.CC(C)Nc1n[nH]c(=O)c2ccccc12.Nc1n[nH]c(=O)c2ccccc12.
What is the InChIKey of 4-amino-2H-phthalazin-1-one;methane;4-(propan-2-ylamino)-2H-phthalazin-1-one?
The InChIKey is SBUJOJWBXSVQAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O.C8H7N3O.CH4/c1-7(2)12-10-8-5-3-4-6-9(8)11(15)14-13-10;9-7-5-3-1-2-4-6(5)8(12)11-10-7;/h3-7H,1-2H3,(H,12,13)(H,14,15);1-4H,(H2,9,10)(H,11,12);1H4.
What are the key properties of 4-amino-2H-phthalazin-1-one;methane;4-(propan-2-ylamino)-2H-phthalazin-1-one?
4-amino-2H-phthalazin-1-one;methane;4-(propan-2-ylamino)-2H-phthalazin-1-one has a molecular weight of 380.45 g/mol, XLogP of 2.88, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2H-phthalazin-1-one;methane;4-(propan-2-ylamino)-2H-phthalazin-1-one is sourced from PubChem (CID 160790771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).