C20H24N6O2 — CID 160790771
4-amino-2H-phthalazin-1-one;methane;4-(propan-2-ylamino)-2H-phthalazin-1-one (PubChem CID 160790771) has the molecular formula C20H24N6O2 and a molecular weight of 380.45 g/mol. Its IUPAC name is 4-amino-2H-phthalazin-1-one;methane;4-(propan-2-ylamino)-2H-phthalazin-1-one.
| Compound Name | 4-amino-2H-phthalazin-1-one;methane;4-(propan-2-ylamino)-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 160790771 |
| Molecular Formula | C20H24N6O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 4-amino-2H-phthalazin-1-one;methane;4-(propan-2-ylamino)-2H-phthalazin-1-one |
| SMILES | C.CC(C)Nc1n[nH]c(=O)c2ccccc12.Nc1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C11H13N3O.C8H7N3O.CH4/c1-7(2)12-10-8-5-3-4-6-9(8)11(15)14-13-10;9-7-5-3-1-2-4-6(5)8(12)11-10-7;/h3-7H,1-2H3,(H,12,13)(H,14,15);1-4H,(H2,9,10)(H,11,12);1H4 |
| InChIKey | SBUJOJWBXSVQAB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 129.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |