C18H18F2O4S — CID 20820606
[2-ethoxy-2,2-difluoro-1-(4-methoxyphenyl)ethoxy]-phenoxymethanethione (PubChem CID 20820606) has the molecular formula C18H18F2O4S and a molecular weight of 368.40 g/mol. Its IUPAC name is [2-ethoxy-2,2-difluoro-1-(4-methoxyphenyl)ethoxy]-phenoxymethanethione.
| Compound Name | [2-ethoxy-2,2-difluoro-1-(4-methoxyphenyl)ethoxy]-phenoxymethanethione |
|---|---|
| PubChem CID | 20820606 |
| Molecular Formula | C18H18F2O4S |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | [2-ethoxy-2,2-difluoro-1-(4-methoxyphenyl)ethoxy]-phenoxymethanethione |
| SMILES | CCOC(F)(F)C(OC(=S)Oc1ccccc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H18F2O4S/c1-3-22-18(19,20)16(13-9-11-14(21-2)12-10-13)24-17(25)23-15-7-5-4-6-8-15/h4-12,16H,3H2,1-2H3 |
| InChIKey | KVSYFKQBWOIHPN-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|