C16H19FO4 — CID 166634138
8-[1-(3-fluoro-4-methoxyphenyl)ethenyl]-6,7,10-trioxaspiro[4.5]decane (PubChem CID 166634138) has the molecular formula C16H19FO4 and a molecular weight of 294.32 g/mol. Its IUPAC name is 8-[1-(3-fluoro-4-methoxyphenyl)ethenyl]-6,7,10-trioxaspiro[4.5]decane.
| Compound Name | 8-[1-(3-fluoro-4-methoxyphenyl)ethenyl]-6,7,10-trioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 166634138 |
| Molecular Formula | C16H19FO4 |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 8-[1-(3-fluoro-4-methoxyphenyl)ethenyl]-6,7,10-trioxaspiro[4.5]decane |
| SMILES | C=C(c1ccc(OC)c(F)c1)C1COC2(CCCC2)OO1 |
| InChI | InChI=1S/C16H19FO4/c1-11(12-5-6-14(18-2)13(17)9-12)15-10-19-16(21-20-15)7-3-4-8-16/h5-6,9,15H,1,3-4,7-8,10H2,2H3 |
| InChIKey | YBEOIQBEBRQZSN-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|