C32H38O8 — CID 25157540
8-[1-[4-[2-[4-[1-(6,7,10-trioxaspiro[4.5]decan-8-yl)ethenyl]phenoxy]ethoxy]phenyl]ethenyl]-6,7,10-trioxaspiro[4.5]decane (PubChem CID 25157540) has the molecular formula C32H38O8 and a molecular weight of 550.65 g/mol. Its IUPAC name is 8-[1-[4-[2-[4-[1-(6,7,10-trioxaspiro[4.5]decan-8-yl)ethenyl]phenoxy]ethoxy]phenyl]ethenyl]-6,7,10-trioxaspiro[4.5]decane.
| Compound Name | 8-[1-[4-[2-[4-[1-(6,7,10-trioxaspiro[4.5]decan-8-yl)ethenyl]phenoxy]ethoxy]phenyl]ethenyl]-6,7,10-trioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 25157540 |
| Molecular Formula | C32H38O8 |
| Molecular Weight | 550.65 g/mol |
| Exact Mass | 550.26 |
| IUPAC Name | 8-[1-[4-[2-[4-[1-(6,7,10-trioxaspiro[4.5]decan-8-yl)ethenyl]phenoxy]ethoxy]phenyl]ethenyl]-6,7,10-trioxaspiro[4.5]decane |
| SMILES | C=C(c1ccc(OCCOc2ccc(C(=C)C3COC4(CCCC4)OO3)cc2)cc1)C1COC2(CCCC2)OO1 |
| InChI | InChI=1S/C32H38O8/c1-23(29-21-35-31(39-37-29)15-3-4-16-31)25-7-11-27(12-8-25)33-19-20-34-28-13-9-26(10-14-28)24(2)30-22-36-32(40-38-30)17-5-6-18-32/h7-14,29-30H,1-6,15-22H2 |
| InChIKey | KGMZPHIRNGUERY-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.65 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|