C35H42ClN5O7 — CID 20820923
4-[[2-(3-benzyl-4-ethoxy-2,5-dioxoimidazolidin-1-yl)-3-(2,4-dimethyl-1,3-oxazol-5-yl)-3-oxopropanoyl]amino]-3-chloro-N-octylbenzamide (PubChem CID 20820923) has the molecular formula C35H42ClN5O7 and a molecular weight of 680.20 g/mol. Its IUPAC name is 4-[[2-(3-benzyl-4-ethoxy-2,5-dioxoimidazolidin-1-yl)-3-(2,4-dimethyl-1,3-oxazol-5-yl)-3-oxopropanoyl]amino]-3-chloro-N-octylbenzamide.
| Compound Name | 4-[[2-(3-benzyl-4-ethoxy-2,5-dioxoimidazolidin-1-yl)-3-(2,4-dimethyl-1,3-oxazol-5-yl)-3-oxopropanoyl]amino]-3-chloro-N-octylbenzamide |
|---|---|
| PubChem CID | 20820923 |
| Molecular Formula | C35H42ClN5O7 |
| Molecular Weight | 680.20 g/mol |
| Exact Mass | 679.28 |
| IUPAC Name | 4-[[2-(3-benzyl-4-ethoxy-2,5-dioxoimidazolidin-1-yl)-3-(2,4-dimethyl-1,3-oxazol-5-yl)-3-oxopropanoyl]amino]-3-chloro-N-octylbenzamide |
| SMILES | CCCCCCCCNC(=O)c1ccc(NC(=O)C(C(=O)c2oc(C)nc2C)N2C(=O)C(OCC)N(Cc3ccccc3)C2=O)c(Cl)c1 |
| InChI | InChI=1S/C35H42ClN5O7/c1-5-7-8-9-10-14-19-37-31(43)25-17-18-27(26(36)20-25)39-32(44)28(29(42)30-22(3)38-23(4)48-30)41-33(45)34(47-6-2)40(35(41)46)21-24-15-12-11-13-16-24/h11-13,15-18,20,28,34H,5-10,14,19,21H2,1-4H3,(H,37,43)(H,39,44) |
| InChIKey | VSRWLVVPBCMCBE-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 151.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.20 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|