C44H42ClN3O7S2 — CID 20820929
4-[[3-(1,2-benzothiazol-3-yl)-3-oxo-2-[4-(4-phenylmethoxyphenyl)sulfonylphenoxy]propanoyl]amino]-3-chloro-N-octylbenzamide (PubChem CID 20820929) has the molecular formula C44H42ClN3O7S2 and a molecular weight of 824.42 g/mol. Its IUPAC name is 4-[[3-(1,2-benzothiazol-3-yl)-3-oxo-2-[4-(4-phenylmethoxyphenyl)sulfonylphenoxy]propanoyl]amino]-3-chloro-N-octylbenzamide.
| Compound Name | 4-[[3-(1,2-benzothiazol-3-yl)-3-oxo-2-[4-(4-phenylmethoxyphenyl)sulfonylphenoxy]propanoyl]amino]-3-chloro-N-octylbenzamide |
|---|---|
| PubChem CID | 20820929 |
| Molecular Formula | C44H42ClN3O7S2 |
| Molecular Weight | 824.42 g/mol |
| Exact Mass | 823.22 |
| IUPAC Name | 4-[[3-(1,2-benzothiazol-3-yl)-3-oxo-2-[4-(4-phenylmethoxyphenyl)sulfonylphenoxy]propanoyl]amino]-3-chloro-N-octylbenzamide |
| SMILES | CCCCCCCCNC(=O)c1ccc(NC(=O)C(Oc2ccc(S(=O)(=O)c3ccc(OCc4ccccc4)cc3)cc2)C(=O)c2nsc3ccccc23)c(Cl)c1 |
| InChI | InChI=1S/C44H42ClN3O7S2/c1-2-3-4-5-6-12-27-46-43(50)31-17-26-38(37(45)28-31)47-44(51)42(41(49)40-36-15-10-11-16-39(36)56-48-40)55-33-20-24-35(25-21-33)57(52,53)34-22-18-32(19-23-34)54-29-30-13-8-7-9-14-30/h7-11,13-26,28,42H,2-6,12,27,29H2,1H3,(H,46,50)(H,47,51) |
| InChIKey | UQMQABMYPZNMBM-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 140.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.42 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|