C41H53ClN4O7 — CID 20722333
2-(3-benzyl-4-ethoxy-2,5-dioxoimidazolidin-1-yl)-N-[2-chloro-5-[1-[4-methyl-2-(2-methylbutan-2-yl)phenoxy]propoxymethylamino]phenyl]-4,4-dimethyl-3-oxopentanamide (PubChem CID 20722333) has the molecular formula C41H53ClN4O7 and a molecular weight of 749.35 g/mol. Its IUPAC name is 2-(3-benzyl-4-ethoxy-2,5-dioxoimidazolidin-1-yl)-N-[2-chloro-5-[1-[4-methyl-2-(2-methylbutan-2-yl)phenoxy]propoxymethylamino]phenyl]-4,4-dimethyl-3-oxopentanamide.
| Compound Name | 2-(3-benzyl-4-ethoxy-2,5-dioxoimidazolidin-1-yl)-N-[2-chloro-5-[1-[4-methyl-2-(2-methylbutan-2-yl)phenoxy]propoxymethylamino]phenyl]-4,4-dimethyl-3-oxopentanamide |
|---|---|
| PubChem CID | 20722333 |
| Molecular Formula | C41H53ClN4O7 |
| Molecular Weight | 749.35 g/mol |
| Exact Mass | 748.36 |
| IUPAC Name | 2-(3-benzyl-4-ethoxy-2,5-dioxoimidazolidin-1-yl)-N-[2-chloro-5-[1-[4-methyl-2-(2-methylbutan-2-yl)phenoxy]propoxymethylamino]phenyl]-4,4-dimethyl-3-oxopentanamide |
| SMILES | CCOC1C(=O)N(C(C(=O)Nc2cc(NCOC(CC)Oc3ccc(C)cc3C(C)(C)CC)ccc2Cl)C(=O)C(C)(C)C)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C41H53ClN4O7/c1-10-33(53-32-21-18-26(4)22-29(32)41(8,9)11-2)52-25-43-28-19-20-30(42)31(23-28)44-36(48)34(35(47)40(5,6)7)46-37(49)38(51-12-3)45(39(46)50)24-27-16-14-13-15-17-27/h13-23,33-34,38,43H,10-12,24-25H2,1-9H3,(H,44,48) |
| InChIKey | MVEXPEUHXBIERY-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 126.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.35 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|