C34H37ClN4O7 — CID 59117935
1-[1-[2-chloro-5-[1-(2,4-dimethylphenoxy)propoxymethylamino]anilino]-1,3-dioxo-3-(2,4,6-trimethylphenoxy)propan-2-yl]pyrazole-4-carboxylic acid (PubChem CID 59117935) has the molecular formula C34H37ClN4O7 and a molecular weight of 649.14 g/mol. Its IUPAC name is 1-[1-[2-chloro-5-[1-(2,4-dimethylphenoxy)propoxymethylamino]anilino]-1,3-dioxo-3-(2,4,6-trimethylphenoxy)propan-2-yl]pyrazole-4-carboxylic acid.
| Compound Name | 1-[1-[2-chloro-5-[1-(2,4-dimethylphenoxy)propoxymethylamino]anilino]-1,3-dioxo-3-(2,4,6-trimethylphenoxy)propan-2-yl]pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 59117935 |
| Molecular Formula | C34H37ClN4O7 |
| Molecular Weight | 649.14 g/mol |
| Exact Mass | 648.24 |
| IUPAC Name | 1-[1-[2-chloro-5-[1-(2,4-dimethylphenoxy)propoxymethylamino]anilino]-1,3-dioxo-3-(2,4,6-trimethylphenoxy)propan-2-yl]pyrazole-4-carboxylic acid |
| SMILES | CCC(OCNc1ccc(Cl)c(NC(=O)C(C(=O)Oc2c(C)cc(C)cc2C)n2cc(C(=O)O)cn2)c1)Oc1ccc(C)cc1C |
| InChI | InChI=1S/C34H37ClN4O7/c1-7-29(45-28-11-8-19(2)12-21(28)4)44-18-36-25-9-10-26(35)27(15-25)38-32(40)30(39-17-24(16-37-39)33(41)42)34(43)46-31-22(5)13-20(3)14-23(31)6/h8-17,29-30,36H,7,18H2,1-6H3,(H,38,40)(H,41,42) |
| InChIKey | XDVGUHGJFXKAJX-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 141.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.14 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|