C26H30ClN3O5 — CID 23380028
2-(4-benzyl-3-ethoxy-2,5-dioxoimidazolidin-1-yl)-N-(2-chloro-5-methylphenyl)-4,4-dimethyl-3-oxopentanamide (PubChem CID 23380028) has the molecular formula C26H30ClN3O5 and a molecular weight of 500.00 g/mol. Its IUPAC name is 2-(4-benzyl-3-ethoxy-2,5-dioxoimidazolidin-1-yl)-N-(2-chloro-5-methylphenyl)-4,4-dimethyl-3-oxopentanamide.
| Compound Name | 2-(4-benzyl-3-ethoxy-2,5-dioxoimidazolidin-1-yl)-N-(2-chloro-5-methylphenyl)-4,4-dimethyl-3-oxopentanamide |
|---|---|
| PubChem CID | 23380028 |
| Molecular Formula | C26H30ClN3O5 |
| Molecular Weight | 500.00 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | 2-(4-benzyl-3-ethoxy-2,5-dioxoimidazolidin-1-yl)-N-(2-chloro-5-methylphenyl)-4,4-dimethyl-3-oxopentanamide |
| SMILES | CCON1C(=O)N(C(C(=O)Nc2cc(C)ccc2Cl)C(=O)C(C)(C)C)C(=O)C1Cc1ccccc1 |
| InChI | InChI=1S/C26H30ClN3O5/c1-6-35-30-20(15-17-10-8-7-9-11-17)24(33)29(25(30)34)21(22(31)26(3,4)5)23(32)28-19-14-16(2)12-13-18(19)27/h7-14,20-21H,6,15H2,1-5H3,(H,28,32) |
| InChIKey | CBXDZLGIIRSHGA-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.00 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|