C28H24ClN5O5 — CID 23562173
N-(2-chloro-5-methylphenyl)-2-(4-methoxy-3-methyl-2,5-dioxoimidazolidin-1-yl)-3-oxo-3-(1-phenylindazol-3-yl)propanamide (PubChem CID 23562173) has the molecular formula C28H24ClN5O5 and a molecular weight of 545.98 g/mol. Its IUPAC name is N-(2-chloro-5-methylphenyl)-2-(4-methoxy-3-methyl-2,5-dioxoimidazolidin-1-yl)-3-oxo-3-(1-phenylindazol-3-yl)propanamide.
| Compound Name | N-(2-chloro-5-methylphenyl)-2-(4-methoxy-3-methyl-2,5-dioxoimidazolidin-1-yl)-3-oxo-3-(1-phenylindazol-3-yl)propanamide |
|---|---|
| PubChem CID | 23562173 |
| Molecular Formula | C28H24ClN5O5 |
| Molecular Weight | 545.98 g/mol |
| Exact Mass | 545.15 |
| IUPAC Name | N-(2-chloro-5-methylphenyl)-2-(4-methoxy-3-methyl-2,5-dioxoimidazolidin-1-yl)-3-oxo-3-(1-phenylindazol-3-yl)propanamide |
| SMILES | COC1C(=O)N(C(C(=O)Nc2cc(C)ccc2Cl)C(=O)c2nn(-c3ccccc3)c3ccccc23)C(=O)N1C |
| InChI | InChI=1S/C28H24ClN5O5/c1-16-13-14-19(29)20(15-16)30-25(36)23(33-26(37)27(39-3)32(2)28(33)38)24(35)22-18-11-7-8-12-21(18)34(31-22)17-9-5-4-6-10-17/h4-15,23,27H,1-3H3,(H,30,36) |
| InChIKey | ROXWUEPFXSISHC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 113.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.98 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|