C12H12N2O2S — CID 2082412
4-methoxy-N-(3-methyl-1,3-thiazol-2-ylidene)benzamide (PubChem CID 2082412) has the molecular formula C12H12N2O2S and a molecular weight of 248.31 g/mol. Its IUPAC name is 4-methoxy-N-(3-methyl-1,3-thiazol-2-ylidene)benzamide.
| Compound Name | 4-methoxy-N-(3-methyl-1,3-thiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 2082412 |
| Molecular Formula | C12H12N2O2S |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 4-methoxy-N-(3-methyl-1,3-thiazol-2-ylidene)benzamide |
| SMILES | COc1ccc(C(=O)/N=c2\sccn2C)cc1 |
| InChI | InChI=1S/C12H12N2O2S/c1-14-7-8-17-12(14)13-11(15)9-3-5-10(16-2)6-4-9/h3-8H,1-2H3/b13-12- |
| InChIKey | SQDWSMPIRGBKQX-SEYXRHQNSA-N |
| XLogP | 1.84 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |