C15H24N2 — CID 20825924
N-ethyl-N-[(2-methanidyl-1,2,3,4-tetrahydroisoquinolin-2-ium-5-yl)methyl]ethanamine (PubChem CID 20825924) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is N-ethyl-N-[(2-methanidyl-1,2,3,4-tetrahydroisoquinolin-2-ium-5-yl)methyl]ethanamine.
| Compound Name | N-ethyl-N-[(2-methanidyl-1,2,3,4-tetrahydroisoquinolin-2-ium-5-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 20825924 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | N-ethyl-N-[(2-methanidyl-1,2,3,4-tetrahydroisoquinolin-2-ium-5-yl)methyl]ethanamine |
| SMILES | [CH2-][NH+]1CCc2c(CN(CC)CC)cccc2C1 |
| InChI | InChI=1S/C15H24N2/c1-4-17(5-2)12-14-8-6-7-13-11-16(3)10-9-15(13)14/h6-8,16H,3-5,9-12H2,1-2H3 |
| InChIKey | BUBCEPGLDAPTPS-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|