C28H31N5O3 — CID 20826203
methyl 3-[2-[(4-carbamimidoylanilino)methyl]-4-ethenylphenyl]-6-(2-methylpropylcarbamoyl)pyridine-2-carboxylate (PubChem CID 20826203) has the molecular formula C28H31N5O3 and a molecular weight of 485.59 g/mol. Its IUPAC name is methyl 3-[2-[(4-carbamimidoylanilino)methyl]-4-ethenylphenyl]-6-(2-methylpropylcarbamoyl)pyridine-2-carboxylate.
| Compound Name | methyl 3-[2-[(4-carbamimidoylanilino)methyl]-4-ethenylphenyl]-6-(2-methylpropylcarbamoyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 20826203 |
| Molecular Formula | C28H31N5O3 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | methyl 3-[2-[(4-carbamimidoylanilino)methyl]-4-ethenylphenyl]-6-(2-methylpropylcarbamoyl)pyridine-2-carboxylate |
| SMILES | [H]/N=C(\N)c1ccc(NCc2cc(C=C)ccc2-c2ccc(C(=O)NCC(C)C)nc2C(=O)OC)cc1 |
| InChI | InChI=1S/C28H31N5O3/c1-5-18-6-11-22(20(14-18)16-31-21-9-7-19(8-10-21)26(29)30)23-12-13-24(27(34)32-15-17(2)3)33-25(23)28(35)36-4/h5-14,17,31H,1,15-16H2,2-4H3,(H3,29,30)(H,32,34) |
| InChIKey | LYCZYVAXLVEXMJ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 130.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|