C14H14BrClN4O2S — CID 20828163
N'-(5-bromo-2-methylsulfanylpyrimidin-4-yl)-2-chloro-5-methoxy-N'-methylbenzohydrazide (PubChem CID 20828163) has the molecular formula C14H14BrClN4O2S and a molecular weight of 417.72 g/mol. Its IUPAC name is N'-(5-bromo-2-methylsulfanylpyrimidin-4-yl)-2-chloro-5-methoxy-N'-methylbenzohydrazide.
| Compound Name | N'-(5-bromo-2-methylsulfanylpyrimidin-4-yl)-2-chloro-5-methoxy-N'-methylbenzohydrazide |
|---|---|
| PubChem CID | 20828163 |
| Molecular Formula | C14H14BrClN4O2S |
| Molecular Weight | 417.72 g/mol |
| Exact Mass | 415.97 |
| IUPAC Name | N'-(5-bromo-2-methylsulfanylpyrimidin-4-yl)-2-chloro-5-methoxy-N'-methylbenzohydrazide |
| SMILES | COc1ccc(Cl)c(C(=O)NN(C)c2nc(SC)ncc2Br)c1 |
| InChI | InChI=1S/C14H14BrClN4O2S/c1-20(12-10(15)7-17-14(18-12)23-3)19-13(21)9-6-8(22-2)4-5-11(9)16/h4-7H,1-3H3,(H,19,21) |
| InChIKey | UJLZWUVNSNCEHO-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.72 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|