C14H9Cl2F3N2 — CID 20829776
2,6-dichloro-4-(2-cyclopropylethynyl)-4-(trifluoromethyl)-1H-quinazoline (PubChem CID 20829776) has the molecular formula C14H9Cl2F3N2 and a molecular weight of 333.14 g/mol. Its IUPAC name is 2,6-dichloro-4-(2-cyclopropylethynyl)-4-(trifluoromethyl)-1H-quinazoline.
| Compound Name | 2,6-dichloro-4-(2-cyclopropylethynyl)-4-(trifluoromethyl)-1H-quinazoline |
|---|---|
| PubChem CID | 20829776 |
| Molecular Formula | C14H9Cl2F3N2 |
| Molecular Weight | 333.14 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | 2,6-dichloro-4-(2-cyclopropylethynyl)-4-(trifluoromethyl)-1H-quinazoline |
| SMILES | FC(F)(F)C1(C#CC2CC2)N=C(Cl)Nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C14H9Cl2F3N2/c15-9-3-4-11-10(7-9)13(14(17,18)19,21-12(16)20-11)6-5-8-1-2-8/h3-4,7-8H,1-2H2,(H,20,21) |
| InChIKey | FCSYXGGZPSULDB-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.14 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|