C18H13ClF3NO6 — CID 175206874
(E)-but-2-enedioic acid;(4S)-6-chloro-4-(2-cyclopropylethynyl)-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one (PubChem CID 175206874) has the molecular formula C18H13ClF3NO6 and a molecular weight of 431.75 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;(4S)-6-chloro-4-(2-cyclopropylethynyl)-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one.
| Compound Name | (E)-but-2-enedioic acid;(4S)-6-chloro-4-(2-cyclopropylethynyl)-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one |
|---|---|
| PubChem CID | 175206874 |
| Molecular Formula | C18H13ClF3NO6 |
| Molecular Weight | 431.75 g/mol |
| Exact Mass | 431.04 |
| IUPAC Name | (E)-but-2-enedioic acid;(4S)-6-chloro-4-(2-cyclopropylethynyl)-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one |
| SMILES | O=C(O)/C=C/C(=O)O.O=C1Nc2ccc(Cl)cc2[C@@](C#CC2CC2)(C(F)(F)F)O1 |
| InChI | InChI=1S/C14H9ClF3NO2.C4H4O4/c15-9-3-4-11-10(7-9)13(14(16,17)18,21-12(20)19-11)6-5-8-1-2-8;5-3(6)1-2-4(7)8/h3-4,7-8H,1-2H2,(H,19,20);1-2H,(H,5,6)(H,7,8)/b;2-1+/t13-;/m0./s1 |
| InChIKey | YXFGYHYGQHBTSD-QDSMGTAFSA-N |
| XLogP | 3.78 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.75 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|