C14H8ClF3NNaO2 — CID 51039619
sodium (4S)-6-chloro-4-(2-cyclopropylethynyl)-4-(trifluoromethyl)-3,1-benzoxazin-1-id-2-one (PubChem CID 51039619) has the molecular formula C14H8ClF3NNaO2 and a molecular weight of 337.66 g/mol. Its IUPAC name is sodium (4S)-6-chloro-4-(2-cyclopropylethynyl)-4-(trifluoromethyl)-3,1-benzoxazin-1-id-2-one.
| Compound Name | sodium (4S)-6-chloro-4-(2-cyclopropylethynyl)-4-(trifluoromethyl)-3,1-benzoxazin-1-id-2-one |
|---|---|
| PubChem CID | 51039619 |
| Molecular Formula | C14H8ClF3NNaO2 |
| Molecular Weight | 337.66 g/mol |
| Exact Mass | 337.01 |
| IUPAC Name | sodium (4S)-6-chloro-4-(2-cyclopropylethynyl)-4-(trifluoromethyl)-3,1-benzoxazin-1-id-2-one |
| SMILES | O=C1[N-]c2ccc(Cl)cc2[C@@](C#CC2CC2)(C(F)(F)F)O1.[Na+] |
| InChI | InChI=1S/C14H9ClF3NO2.Na/c15-9-3-4-11-10(7-9)13(14(16,17)18,21-12(20)19-11)6-5-8-1-2-8;/h3-4,7-8H,1-2H2,(H,19,20);/q;+1/p-1/t13-;/m0./s1 |
| InChIKey | BNLGJAHUUQHCAV-ZOWNYOTGSA-M |
| XLogP | 1.67 |
| TPSA | 40.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.66 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|