C20H14Cl2N4OS — CID 20829779
4-[2-(2,6-dichlorophenyl)-3-hydroxy-5-phenylimidazol-4-yl]-2-methylsulfanylpyrimidine (PubChem CID 20829779) has the molecular formula C20H14Cl2N4OS and a molecular weight of 429.33 g/mol. Its IUPAC name is 4-[2-(2,6-dichlorophenyl)-3-hydroxy-5-phenylimidazol-4-yl]-2-methylsulfanylpyrimidine.
| Compound Name | 4-[2-(2,6-dichlorophenyl)-3-hydroxy-5-phenylimidazol-4-yl]-2-methylsulfanylpyrimidine |
|---|---|
| PubChem CID | 20829779 |
| Molecular Formula | C20H14Cl2N4OS |
| Molecular Weight | 429.33 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | 4-[2-(2,6-dichlorophenyl)-3-hydroxy-5-phenylimidazol-4-yl]-2-methylsulfanylpyrimidine |
| SMILES | CSc1nccc(-c2c(-c3ccccc3)nc(-c3c(Cl)cccc3Cl)n2O)n1 |
| InChI | InChI=1S/C20H14Cl2N4OS/c1-28-20-23-11-10-15(24-20)18-17(12-6-3-2-4-7-12)25-19(26(18)27)16-13(21)8-5-9-14(16)22/h2-11,27H,1H3 |
| InChIKey | HYYLNTGQXOQZHP-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.33 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|