C25H24Cl2N4O6S — CID 22322007
3-[3,5-dichloro-4-[1-hydroxy-4-[3-(methoxymethoxy)phenyl]-5-(2-methylsulfanylpyrimidin-4-yl)imidazol-2-yl]phenoxy]propane-1,2-diol (PubChem CID 22322007) has the molecular formula C25H24Cl2N4O6S and a molecular weight of 579.46 g/mol. Its IUPAC name is 3-[3,5-dichloro-4-[1-hydroxy-4-[3-(methoxymethoxy)phenyl]-5-(2-methylsulfanylpyrimidin-4-yl)imidazol-2-yl]phenoxy]propane-1,2-diol.
| Compound Name | 3-[3,5-dichloro-4-[1-hydroxy-4-[3-(methoxymethoxy)phenyl]-5-(2-methylsulfanylpyrimidin-4-yl)imidazol-2-yl]phenoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 22322007 |
| Molecular Formula | C25H24Cl2N4O6S |
| Molecular Weight | 579.46 g/mol |
| Exact Mass | 578.08 |
| IUPAC Name | 3-[3,5-dichloro-4-[1-hydroxy-4-[3-(methoxymethoxy)phenyl]-5-(2-methylsulfanylpyrimidin-4-yl)imidazol-2-yl]phenoxy]propane-1,2-diol |
| SMILES | COCOc1cccc(-c2nc(-c3c(Cl)cc(OCC(O)CO)cc3Cl)n(O)c2-c2ccnc(SC)n2)c1 |
| InChI | InChI=1S/C25H24Cl2N4O6S/c1-35-13-37-16-5-3-4-14(8-16)22-23(20-6-7-28-25(29-20)38-2)31(34)24(30-22)21-18(26)9-17(10-19(21)27)36-12-15(33)11-32/h3-10,15,32-34H,11-13H2,1-2H3 |
| InChIKey | VYWYVMLTHGOWRA-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 131.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.46 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|