About CID 20835787
CID 20835787 (PubChem CID 20835787) has the molecular formula C4H9O2Si
and a molecular weight of 117.20 g/mol.
Molecular Properties
| Compound Name | CID 20835787 |
| PubChem CID | 20835787 |
| Molecular Formula | C4H9O2Si |
| Molecular Weight | 117.20 g/mol |
| Exact Mass | 117.04 |
| IUPAC Name | — |
| SMILES | CCOC([Si])OC |
| InChI | InChI=1S/C4H9O2Si/c1-3-6-4(7)5-2/h4H,3H2,1-2H3 |
| InChIKey | ALWZDXRBYVBJBS-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.20 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze CID 20835787 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 20835787?
The IUPAC name of CID 20835787 (CID 20835787) is not available.
What is the SMILES notation for CID 20835787?
The canonical SMILES for CID 20835787 is CCOC([Si])OC.
What is the InChIKey of CID 20835787?
The InChIKey is ALWZDXRBYVBJBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9O2Si/c1-3-6-4(7)5-2/h4H,3H2,1-2H3.
What are the key properties of CID 20835787?
CID 20835787 has a molecular weight of 117.20 g/mol, XLogP of 0.12, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 20835787 is sourced from PubChem (CID 20835787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).