C8H12Cl3O4P — CID 20836176
diethyl [(1E)-2,4,4-trichlorobuta-1,3-dienyl] phosphate (PubChem CID 20836176) has the molecular formula C8H12Cl3O4P and a molecular weight of 309.50 g/mol. Its IUPAC name is diethyl [(1E)-2,4,4-trichlorobuta-1,3-dienyl] phosphate.
| Compound Name | diethyl [(1E)-2,4,4-trichlorobuta-1,3-dienyl] phosphate |
|---|---|
| PubChem CID | 20836176 |
| Molecular Formula | C8H12Cl3O4P |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 307.95 |
| IUPAC Name | diethyl [(1E)-2,4,4-trichlorobuta-1,3-dienyl] phosphate |
| SMILES | CCOP(=O)(OCC)O/C=C(\C=C(Cl)Cl)/Cl |
| InChI | InChI=1S/C8H12Cl3O4P/c1-3-13-16(12,14-4-2)15-6-7(9)5-8(10)11/h5-6H,3-4H2,1-2H3/b7-6+ |
| InChIKey | OBOWFNLWGVYPDT-VOTSOKGWSA-N |
| XLogP | 3.20 |
| TPSA | 44.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | 302 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|