C26H30N2O9-4 — CID 20838508
bis((Z)-but-2-enedioate);1-(4-cyclopentylphenyl)-2-(4-methylpiperazin-1-yl)ethanone (PubChem CID 20838508) has the molecular formula C26H30N2O9-4 and a molecular weight of 514.53 g/mol. Its IUPAC name is bis((Z)-but-2-enedioate);1-(4-cyclopentylphenyl)-2-(4-methylpiperazin-1-yl)ethanone.
| Compound Name | bis((Z)-but-2-enedioate);1-(4-cyclopentylphenyl)-2-(4-methylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 20838508 |
| Molecular Formula | C26H30N2O9-4 |
| Molecular Weight | 514.53 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | bis((Z)-but-2-enedioate);1-(4-cyclopentylphenyl)-2-(4-methylpiperazin-1-yl)ethanone |
| SMILES | CN1CCN(CC(=O)c2ccc(C3CCCC3)cc2)CC1.O=C([O-])/C=C\C(=O)[O-].O=C([O-])/C=C\C(=O)[O-] |
| InChI | InChI=1S/C18H26N2O.2C4H4O4/c1-19-10-12-20(13-11-19)14-18(21)17-8-6-16(7-9-17)15-4-2-3-5-15;2*5-3(6)1-2-4(7)8/h6-9,15H,2-5,10-14H2,1H3;2*1-2H,(H,5,6)(H,7,8)/p-4/b;2*2-1- |
| InChIKey | ROVSZMARIWBEAL-SPIKMXEPSA-J |
| XLogP | -3.14 |
| TPSA | 184.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.53 |
| LogP ≤ 5 | -3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|